cas: 339161-04-5 — see every product listed under this CAS number, including other names
(2R,3S)-3-Amino-2-Hydroxy-Butyric Acid Hydrochloride, 95%, 95% (CAS 339161-04-5) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114AKX-25mg |
| cas | 339161-04-5 |
| size | 25mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 990.80 Pln | |
| Chemat | 100mg | 2474.00 Pln | |
| Chemat | 250mg | 3923.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2R,3S)-3-amino-2-hydroxybutanoic acid;hydrochloride (CAS 339161-04-5) is a chemical compound with the molecular formula C4H10ClNO3 and a molecular weight of 155.58 g/mol. IUPAC name: (2R,3S)-3-amino-2-hydroxybutanoic acid;hydrochloride. InChIKey: GNOCKVJSXPCGKD-LJUKVTEVSA-N.
| Molecular formula | C4H10ClNO3 |
|---|---|
| Molecular weight | 155.58 g/mol |
| IUPAC name | (2R,3S)-3-amino-2-hydroxybutanoic acid;hydrochloride |
| InChIKey | GNOCKVJSXPCGKD-LJUKVTEVSA-N |
| SMILES | C[C@@H]([C@H](C(=O)O)O)N.Cl |
Computed by PubChem (NCBI)