CAS 97347-46-1 is the registry number for D-threonine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(2R,3S)-2-amino-3-hydroxybutanoic acid;hydrochloride (CAS 97347-46-1) is a chemical compound with the molecular formula C4H10ClNO3 and a molecular weight of 155.58 g/mol. IUPAC name: (2R,3S)-2-amino-3-hydroxybutanoic acid;hydrochloride. InChIKey: OFSUFJTYFFRWFD-LJUKVTEVSA-N.
| Molecular formula | C4H10ClNO3 |
|---|---|
| Molecular weight | 155.58 g/mol |
| IUPAC name | (2R,3S)-2-amino-3-hydroxybutanoic acid;hydrochloride |
| InChIKey | OFSUFJTYFFRWFD-LJUKVTEVSA-N |
| SMILES | C[C@@H]([C@H](C(=O)O)N)O.Cl |
Computed by PubChem (NCBI)