Products 339161-04-5
CAS 339161-04-5 appears in our catalog under these names: (2R,3S)-3-Amino-2-hydroxy-butyric acid hydrochloride, 95%, (2R,3S)-3-Amino-2-hydroxybutanoic acid hydrochloride, 97%, (2R，3S)–3–amino–2–hydroxybutanoic acid hydrochloride, (2R,3S)-3-Amino-2-Hydroxy-Butyric Acid Hydrochloride, 95%, 95%, (2R,3S)-3-Amino-2-hydroxybutanoic acid hydrochloride, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 25mg, 5mg.
(2R,3S)-3-amino-2-hydroxybutanoic acid;hydrochloride (CAS 339161-04-5) is a chemical compound with the molecular formula C4H10ClNO3 and a molecular weight of 155.58 g/mol. IUPAC name: (2R,3S)-3-amino-2-hydroxybutanoic acid;hydrochloride. InChIKey: GNOCKVJSXPCGKD-LJUKVTEVSA-N.
| Molecular formula | C4H10ClNO3 |
|---|---|
| Molecular weight | 155.58 g/mol |
| IUPAC name | (2R,3S)-3-amino-2-hydroxybutanoic acid;hydrochloride |
| InChIKey | GNOCKVJSXPCGKD-LJUKVTEVSA-N |
| SMILES | C[C@@H]([C@H](C(=O)O)O)N.Cl |
Computed by PubChem (NCBI)