cas: 3601-89-6 — see every product listed under this CAS number, including other names
(2R,3S)-5-Chloro-2-(((4-methylbenzoyl)oxy)methyl)tetrahydrofuran-3-yl 4-methylbenzoate 90% (CAS 3601-89-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A105847-250mg |
| cas | 3601-89-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 259.12 Pln | |
| Ambeed | 10g | 387.06 Pln | |
| Ambeed | 25g | 765.31 Pln | |
| Ambeed | 100g | 2523.06 Pln |
| purity | 90% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A105847 |
[(2R,3S)-5-chloro-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate (CAS 3601-89-6) is a chemical compound with the molecular formula C21H21ClO5 and a molecular weight of 388.8 g/mol. IUPAC name: [(2R,3S)-5-chloro-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate. InChIKey: FJHSYOMVMMNQJQ-PAMZHZACSA-N.
| Molecular formula | C21H21ClO5 |
|---|---|
| Molecular weight | 388.8 g/mol |
| IUPAC name | [(2R,3S)-5-chloro-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate |
| InChIKey | FJHSYOMVMMNQJQ-PAMZHZACSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)OC[C@@H]2[C@H](CC(O2)Cl)OC(=O)C3=CC=C(C=C3)C |
Computed by PubChem (NCBI)