cas: 3601-89-6 — see every product listed under this CAS number, including other names
(2R,3S)-5-Chloro-2-(((4-methylbenzoyl)oxy)methyl)tetrahydrofuran-3-yl 4-methylbenzoate, 90%, 90% (CAS 3601-89-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BXLR-250mg |
| cas | 3601-89-6 |
| size | 250mg |
| availability | 195g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 126.80 Pln | |
| Chemat | 10g | 194.00 Pln | |
| Chemat | 25g | 342.80 Pln | |
| Chemat | 100g | 1106.00 Pln |
| purity | 90% |
|---|---|
| delivery time | 3 weeks |
[(2R,3S)-5-chloro-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate (CAS 3601-89-6) is a chemical compound with the molecular formula C21H21ClO5 and a molecular weight of 388.8 g/mol. IUPAC name: [(2R,3S)-5-chloro-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate. InChIKey: FJHSYOMVMMNQJQ-PAMZHZACSA-N.
| Molecular formula | C21H21ClO5 |
|---|---|
| Molecular weight | 388.8 g/mol |
| IUPAC name | [(2R,3S)-5-chloro-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate |
| InChIKey | FJHSYOMVMMNQJQ-PAMZHZACSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)OC[C@@H]2[C@H](CC(O2)Cl)OC(=O)C3=CC=C(C=C3)C |
Computed by PubChem (NCBI)