cas: 817554-87-3 — see every product listed under this CAS number, including other names
(2R,3S)-tert-Butyl 3-hydroxy-2-methylpyrrolidine-1-carboxylate, 97%, 97% (CAS 817554-87-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G0FD-100mg |
| cas | 817554-87-3 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 870.80 Pln | |
| Chemat | 250mg | 1408.40 Pln | |
| Chemat | 500mg | 2320.40 Pln | |
| Chemat | 1g | 3434.00 Pln | |
| Chemat | 5g | 10173.20 Pln | |
| Chemat | 10g | 16912.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (2R,3S)-3-hydroxy-2-methylpyrrolidine-1-carboxylate (CAS 817554-87-3) is a chemical compound with the molecular formula C10H19NO3 and a molecular weight of 201.26 g/mol. IUPAC name: tert-butyl (2R,3S)-3-hydroxy-2-methylpyrrolidine-1-carboxylate. InChIKey: RLHMCXQTIPFLRQ-SFYZADRCSA-N.
| Molecular formula | C10H19NO3 |
|---|---|
| Molecular weight | 201.26 g/mol |
| IUPAC name | tert-butyl (2R,3S)-3-hydroxy-2-methylpyrrolidine-1-carboxylate |
| InChIKey | RLHMCXQTIPFLRQ-SFYZADRCSA-N |
| SMILES | C[C@@H]1[C@H](CCN1C(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)