cas: 817554-87-3 — see every product listed under this CAS number, including other names
tert-Butyl (2R,3S)-3-hydroxy-2-methylpyrrolidine-1-carboxylate, 97% (CAS 817554-87-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F602460-100MG |
| cas | 817554-87-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1414.10 Pln | |
| Fluorochem | 250mg | 2309.62 Pln | |
| Fluorochem | 500mg | 3814.30 Pln | |
| Fluorochem | 1g | 5662.61 Pln | |
| Fluorochem | 5g | 16825.34 Pln | |
| Fluorochem | 10g | 27993.29 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (2R,3S)-3-hydroxy-2-methylpyrrolidine-1-carboxylate (CAS 817554-87-3) is a chemical compound with the molecular formula C10H19NO3 and a molecular weight of 201.26 g/mol. IUPAC name: tert-butyl (2R,3S)-3-hydroxy-2-methylpyrrolidine-1-carboxylate. InChIKey: RLHMCXQTIPFLRQ-SFYZADRCSA-N.
| Molecular formula | C10H19NO3 |
|---|---|
| Molecular weight | 201.26 g/mol |
| IUPAC name | tert-butyl (2R,3S)-3-hydroxy-2-methylpyrrolidine-1-carboxylate |
| InChIKey | RLHMCXQTIPFLRQ-SFYZADRCSA-N |
| SMILES | C[C@@H]1[C@H](CCN1C(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)