cas: 29702-43-0 — see every product listed under this CAS number, including other names
(2R,3S,4R,5R)-2-Fluoro-3,4,5,6-tetrahydroxyhexanal, 95%, 95% (CAS 29702-43-0) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113Z6B-10mg |
| cas | 29702-43-0 |
| size | 10mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 318.80 Pln | |
| Chemat | 25mg | 563.60 Pln | |
| Chemat | 50mg | 928.40 Pln | |
| Chemat | 100mg | 1533.20 Pln | |
| Chemat | 250mg | 2709.20 Pln | |
| Chemat | 1g | 5930.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-deoxy-2-fluoro-aldehydo-D-glucose is an aldehyde and a 2-deoxy-2-fluoro-D-glucose. It is functionally related to an aldehydo-D-glucose.
Source: ChEBI
| Molecular formula | C6H11FO5 |
|---|---|
| Molecular weight | 182.15 g/mol |
| IUPAC name | (2R,3S,4R,5R)-2-fluoro-3,4,5,6-tetrahydroxyhexanal |
| InChIKey | AOYNUTHNTBLRMT-SLPGGIOYSA-N |
| SMILES | C([C@H]([C@H]([C@@H]([C@H](C=O)F)O)O)O)O |
Computed by PubChem (NCBI)