CAS 4536-08-7 appears in our catalog under these names: 6-Deoxy-6-fluoro-D-glucose, 98%, 6-Deoxy-6-fluoro-D-glucose. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg, 25mg.
(2R,3S,4S,5S)-6-fluoro-2,3,4,5-tetrahydroxyhexanal (CAS 4536-08-7) is a chemical compound with the molecular formula C6H11FO5 and a molecular weight of 182.15 g/mol. IUPAC name: (2R,3S,4S,5S)-6-fluoro-2,3,4,5-tetrahydroxyhexanal. InChIKey: LFIUMOHGAWHPEA-JGWLITMVSA-N.
| Molecular formula | C6H11FO5 |
|---|---|
| Molecular weight | 182.15 g/mol |
| IUPAC name | (2R,3S,4S,5S)-6-fluoro-2,3,4,5-tetrahydroxyhexanal |
| InChIKey | LFIUMOHGAWHPEA-JGWLITMVSA-N |
| SMILES | C([C@H]([C@H]([C@@H]([C@H](C=O)O)O)O)O)F |
Computed by PubChem (NCBI)