cas: 29702-43-0 — see every product listed under this CAS number, including other names
2-deoxy-2-fluoro-D-Glucose (CAS 29702-43-0) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 100mg, 250mg, 500mg, 50mg, 0,1g. Offered by: TargetMol, Chemat, Biosynth.
| brand | TargetMol |
|---|---|
| catalog number | T35682-5mg |
| cas | 29702-43-0 |
| size | 5mg |
| brand | size | price | |
|---|---|---|---|
| TargetMol | 5mg | 718.19 Pln | |
| TargetMol | 10mg | 1143.03 Pln | |
| TargetMol | 25mg | 2053.09 Pln | |
| TargetMol | 100mg | 4709.45 Pln | |
| Chemat | 100mg | 2225.02 Pln | |
| Chemat | 250mg | 4104.16 Pln | |
| Chemat | 25mg | 1236.00 Pln | |
| Chemat | 500mg | 6329.18 Pln | |
| Chemat | 50mg | 1483.35 Pln | |
| Biosynth | 0,1g | price on request | |
| Biosynth | 0,05g | price on request | |
| Biosynth | 0,25g | price on request | |
| Biosynth | 1g | price on request | |
| Biosynth | 0,5g | price on request |
| purity | No data |
|---|---|
| delivery time | on request |
2-deoxy-2-fluoro-aldehydo-D-glucose is an aldehyde and a 2-deoxy-2-fluoro-D-glucose. It is functionally related to an aldehydo-D-glucose.
Source: ChEBI
| Molecular formula | C6H11FO5 |
|---|---|
| Molecular weight | 182.15 g/mol |
| IUPAC name | (2R,3S,4R,5R)-2-fluoro-3,4,5,6-tetrahydroxyhexanal |
| InChIKey | AOYNUTHNTBLRMT-SLPGGIOYSA-N |
| SMILES | C([C@H]([C@H]([C@@H]([C@H](C=O)F)O)O)O)O |
Computed by PubChem (NCBI)