cas: 158567-91-0 — see every product listed under this CAS number, including other names
(2R,4R)-Boc-4-phenyl-pyrrolidine-2-carboxylic acid, 97%, 97% (CAS 158567-91-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114AW4-50mg |
| cas | 158567-91-0 |
| size | 50mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 117.20 Pln | |
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 251.60 Pln | |
| Chemat | 1g | 822.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2R,4R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenylpyrrolidine-2-carboxylic acid (CAS 158567-91-0) is a chemical compound with the molecular formula C16H21NO4 and a molecular weight of 291.34 g/mol. IUPAC name: (2R,4R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenylpyrrolidine-2-carboxylic acid. InChIKey: JDAQDIQHICLYKH-QWHCGFSZSA-N.
| Molecular formula | C16H21NO4 |
|---|---|
| Molecular weight | 291.34 g/mol |
| IUPAC name | (2R,4R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenylpyrrolidine-2-carboxylic acid |
| InChIKey | JDAQDIQHICLYKH-QWHCGFSZSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@@H]1C(=O)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)