CAS 181227-47-4 appears in our catalog under these names: Boc-l-2-indanylglycine, 98%, Boc-L-Igl-OH, Boc-(2-indanyl)-Gly-OH 95%, (S)-2-((tert-Butoxycarbonyl)amino)-2-(2,3-dihydro-1H-inden-2-yl)acetic acid, 95%, 95%. Offered by: Combi-blocks, Iris Biotech, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
(2S)-2-(2,3-dihydro-1H-inden-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 181227-47-4) is a chemical compound with the molecular formula C16H21NO4 and a molecular weight of 291.34 g/mol. IUPAC name: (2S)-2-(2,3-dihydro-1H-inden-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: VCHHRDDQOOBPTC-ZDUSSCGKSA-N.
| Molecular formula | C16H21NO4 |
|---|---|
| Molecular weight | 291.34 g/mol |
| IUPAC name | (2S)-2-(2,3-dihydro-1H-inden-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | VCHHRDDQOOBPTC-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C1CC2=CC=CC=C2C1)C(=O)O |
Computed by PubChem (NCBI)