Products 252008-94-9

CAS 252008-94-9 is the registry number for 2-tert-butyl 3-methyl (3S)-3,4-dihydro-1H-isoquinoline-2,3-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

2-O-tert-butyl 3-O-methyl (3S)-3,4-dihydro-1H-isoquinoline-2,3-dicarboxylate (CAS 252008-94-9) is a chemical compound with the molecular formula C16H21NO4 and a molecular weight of 291.34 g/mol. IUPAC name: 2-O-tert-butyl 3-O-methyl (3S)-3,4-dihydro-1H-isoquinoline-2,3-dicarboxylate. InChIKey: QEZVIPRJZMORTI-ZDUSSCGKSA-N.

Identity
Molecular formulaC16H21NO4
Molecular weight291.34 g/mol
IUPAC name2-O-tert-butyl 3-O-methyl (3S)-3,4-dihydro-1H-isoquinoline-2,3-dicarboxylate
InChIKeyQEZVIPRJZMORTI-ZDUSSCGKSA-N
SMILESCC(C)(C)OC(=O)N1CC2=CC=CC=C2C[C@H]1C(=O)OC

Computed by PubChem (NCBI)