cas: 135042-17-0 — see every product listed under this CAS number, including other names
(2R,4S)-1-tert-Butyl 2-methyl 4-hydroxypyrrolidine-1,2-dicarboxylate, 96%, 96% (CAS 135042-17-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118LK1-250mg |
| cas | 135042-17-0 |
| size | 250mg |
| availability | 1500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 131.60 Pln | |
| Chemat | 10g | 165.20 Pln | |
| Chemat | 25g | 314.00 Pln | |
| Chemat | 100g | 1058.00 Pln | |
| Chemat | 500g | 5116.80 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
1-O-tert-butyl 2-O-methyl (2R,4S)-4-hydroxypyrrolidine-1,2-dicarboxylate (CAS 135042-17-0) is a chemical compound with the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2R,4S)-4-hydroxypyrrolidine-1,2-dicarboxylate. InChIKey: MZMNEDXVUJLQAF-JGVFFNPUSA-N.
| Molecular formula | C11H19NO5 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2R,4S)-4-hydroxypyrrolidine-1,2-dicarboxylate |
| InChIKey | MZMNEDXVUJLQAF-JGVFFNPUSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@@H]1C(=O)OC)O |
Computed by PubChem (NCBI)