CAS 135042-17-0 appears in our catalog under these names: (2R,4S)-1-tert-Butyl 2-methyl 4-hydroxypyrrolidine-1,2-dicarboxylate, 98%, Boc–trans–D–Hyp–OMe, (2R,4S)-1-tert-Butyl 2-methyl 4-hydroxypyrrolidine-1,2-dicarboxylate, (2R,4S)-1-tert-Butyl 2-methyl 4-hydroxypyrrolidine-1,2-dicarboxylate, 96%, 96%, (2R,4S)-1-tert-Butyl 2-methyl 4-hydroxypyrrolidine-1,2-dicarboxylate, 99.81%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100g, 25g, 5g, 10g, 1g, 100mg, 250mg, 250g.
1-O-tert-butyl 2-O-methyl (2R,4S)-4-hydroxypyrrolidine-1,2-dicarboxylate (CAS 135042-17-0) is a chemical compound with the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2R,4S)-4-hydroxypyrrolidine-1,2-dicarboxylate. InChIKey: MZMNEDXVUJLQAF-JGVFFNPUSA-N.
| Molecular formula | C11H19NO5 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2R,4S)-4-hydroxypyrrolidine-1,2-dicarboxylate |
| InChIKey | MZMNEDXVUJLQAF-JGVFFNPUSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@@H]1C(=O)OC)O |
Computed by PubChem (NCBI)