CAS 1145663-09-7 appears in our catalog under these names: Trans-1-tert-butyl 2-methyl 4-hydroxypyrrolidine-1,2-dicarboxylate, 98%, trans-1-tert-Butyl 2-methyl 4-hydroxypyrrolidine-1,2-dicarboxylate, 98%, 98%, rel-Boc-Hyp-OMe, 99.74%, rel-Boc-Hyp-OMe, 98%, Boc-trans-Hyp-OMe, 95%. Offered by: Combi-blocks, Chemat, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 5g, 10g, 1g, 100mg, 250mg, 25g, 1 g.
1-O-tert-butyl 2-O-methyl (2R,4S)-4-hydroxypyrrolidine-1,2-dicarboxylate (CAS 1145663-09-7) is a chemical compound with the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2R,4S)-4-hydroxypyrrolidine-1,2-dicarboxylate. InChIKey: MZMNEDXVUJLQAF-JGVFFNPUSA-N.
| Molecular formula | C11H19NO5 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2R,4S)-4-hydroxypyrrolidine-1,2-dicarboxylate |
| InChIKey | MZMNEDXVUJLQAF-JGVFFNPUSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@@H]1C(=O)OC)O |
Computed by PubChem (NCBI)