cas: 132622-77-6 — see every product listed under this CAS number, including other names
(2R,4S)-4-azido-1-[(tert-butoxy)carbonyl]pyrrolidine-2-carboxylic acid, 95%, 95% (CAS 132622-77-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12BICK-100mg |
| cas | 132622-77-6 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 779.60 Pln | |
| Chemat | 250mg | 1086.80 Pln | |
| Chemat | 1g | 2286.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2R,4S)-4-azido-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 132622-77-6) is a chemical compound with the molecular formula C10H16N4O4 and a molecular weight of 256.26 g/mol. IUPAC name: (2R,4S)-4-azido-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: JZEOWBJXFSZTJU-NKWVEPMBSA-N.
| Molecular formula | C10H16N4O4 |
|---|---|
| Molecular weight | 256.26 g/mol |
| IUPAC name | (2R,4S)-4-azido-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | JZEOWBJXFSZTJU-NKWVEPMBSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@@H]1C(=O)O)N=[N+]=[N-] |
Computed by PubChem (NCBI)