CAS 132622-77-6 appears in our catalog under these names: (2R,4S)-4-Azido-1-(tert-butyloxycarbonyl)pyrrolidine-2-carboxylic acid dcha, 95%, Boc-D-Pro(4-N3)-OH*DCHA (2R,4S), (2R,4S)-4-azido-1-[(tert-butoxy)carbonyl]pyrrolidine-2-carboxylic acid, 95%, 95%, (2R,4S)-Boc-D-Pro(4-N3)-OH. Offered by: Combi-blocks, Iris Biotech, Chemat, MedChemExpress. Available pack sizes: 5g, 1g, 100mg, 250mg, 25g, 500mg, 100 mg, 250 mg.
(2R,4S)-4-azido-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 132622-77-6) is a chemical compound with the molecular formula C10H16N4O4 and a molecular weight of 256.26 g/mol. IUPAC name: (2R,4S)-4-azido-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: JZEOWBJXFSZTJU-NKWVEPMBSA-N.
| Molecular formula | C10H16N4O4 |
|---|---|
| Molecular weight | 256.26 g/mol |
| IUPAC name | (2R,4S)-4-azido-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | JZEOWBJXFSZTJU-NKWVEPMBSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@@H]1C(=O)O)N=[N+]=[N-] |
Computed by PubChem (NCBI)