CAS 132622-68-5 appears in our catalog under these names: (2S,4R)-4-azido-1-((tert-butoxy)carbonyl)pyrrolidine-2-carboxylic acid, (2S,4R)-4-azido-1-[(tert-butoxy)carbonyl]pyrrolidine-2-carboxylic acid, 95%, 95%, Boc-L-Pro(4-N3)-OH*DCHA (2S,4R). Offered by: Biosynth, Chemat, Iris Biotech. Available pack sizes: 1g, 100mg, 250mg, 5g, 25g, 500mg.
(2S,4R)-4-azido-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 132622-68-5) is a chemical compound with the molecular formula C10H16N4O4 and a molecular weight of 256.26 g/mol. IUPAC name: (2S,4R)-4-azido-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: JZEOWBJXFSZTJU-RQJHMYQMSA-N.
| Molecular formula | C10H16N4O4 |
|---|---|
| Molecular weight | 256.26 g/mol |
| IUPAC name | (2S,4R)-4-azido-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | JZEOWBJXFSZTJU-RQJHMYQMSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C[C@H]1C(=O)O)N=[N+]=[N-] |
Computed by PubChem (NCBI)