cas: 149709-44-4 — see every product listed under this CAS number, including other names
(2R,4S)-5-(Biphenyl-4-yl)-4-[(3-carboxypropionyl)amino]-2-methylpentanoic acid, 97%, 97% (CAS 149709-44-4) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112LYJ-1mg |
| cas | 149709-44-4 |
| size | 1mg |
| availability | 0.925g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 112.40 Pln | |
| Chemat | 5mg | 122.00 Pln | |
| Chemat | 10mg | 160.40 Pln | |
| Chemat | 25mg | 266.00 Pln | |
| Chemat | 50mg | 410.00 Pln | |
| Chemat | 100mg | 659.60 Pln | |
| Chemat | 250mg | 1082.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2R,4S)-4-(3-carboxypropanoylamino)-2-methyl-5-(4-phenylphenyl)pentanoic acid (CAS 149709-44-4) is a chemical compound with the molecular formula C22H25NO5 and a molecular weight of 383.4 g/mol. IUPAC name: (2R,4S)-4-(3-carboxypropanoylamino)-2-methyl-5-(4-phenylphenyl)pentanoic acid. InChIKey: DOBNVUFHFMVMDB-BEFAXECRSA-N.
| Molecular formula | C22H25NO5 |
|---|---|
| Molecular weight | 383.4 g/mol |
| IUPAC name | (2R,4S)-4-(3-carboxypropanoylamino)-2-methyl-5-(4-phenylphenyl)pentanoic acid |
| InChIKey | DOBNVUFHFMVMDB-BEFAXECRSA-N |
| SMILES | C[C@H](C[C@@H](CC1=CC=C(C=C1)C2=CC=CC=C2)NC(=O)CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)