CAS 2237216-64-5 is the registry number for Fmoc-(3r,4s)-4-amino-3-hydroxy-5-methyl-hexanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
(3R,4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxy-5-methylhexanoic acid (CAS 2237216-64-5) is a chemical compound with the molecular formula C22H25NO5 and a molecular weight of 383.4 g/mol. IUPAC name: (3R,4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxy-5-methylhexanoic acid. InChIKey: CGAHTEKQUAIZFZ-CTNGQTDRSA-N.
| Molecular formula | C22H25NO5 |
|---|---|
| Molecular weight | 383.4 g/mol |
| IUPAC name | (3R,4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxy-5-methylhexanoic acid |
| InChIKey | CGAHTEKQUAIZFZ-CTNGQTDRSA-N |
| SMILES | CC(C)[C@@H]([C@@H](CC(=O)O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)