CAS 149709-44-4 appears in our catalog under these names: Sacubitril Impurity 4, (2R,4S)-5-([1,1'-Biphenyl]-4-yl)-4-(3-carboxypropanamido)-2-methylpentanoic acid, 98%, (2R,4S)-5-(Biphenyl-4-yl)-4-[(3-carboxypropionyl)amino]-2-methylpentanoic acid, 97%, 97%, Valsartan Impurity 89, Desethyl Sacubitril, >95% (HPLC). Offered by: Chemat Brand, Fluorochem, Chemat, TRC, TargetMol. Available pack sizes: on request, 5mg, 10mg, 25mg, 1mg, 50mg, 100mg, 250mg.
(2R,4S)-4-(3-carboxypropanoylamino)-2-methyl-5-(4-phenylphenyl)pentanoic acid (CAS 149709-44-4) is a chemical compound with the molecular formula C22H25NO5 and a molecular weight of 383.4 g/mol. IUPAC name: (2R,4S)-4-(3-carboxypropanoylamino)-2-methyl-5-(4-phenylphenyl)pentanoic acid. InChIKey: DOBNVUFHFMVMDB-BEFAXECRSA-N.
| Molecular formula | C22H25NO5 |
|---|---|
| Molecular weight | 383.4 g/mol |
| IUPAC name | (2R,4S)-4-(3-carboxypropanoylamino)-2-methyl-5-(4-phenylphenyl)pentanoic acid |
| InChIKey | DOBNVUFHFMVMDB-BEFAXECRSA-N |
| SMILES | C[C@H](C[C@@H](CC1=CC=C(C=C1)C2=CC=CC=C2)NC(=O)CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)