cas: 321744-26-7 — see every product listed under this CAS number, including other names
(2R,4S)-N-Boc-4-hydroxypiperidine-2-carboxylic acid methyl ester, 97% (CAS 321744-26-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F790450-100MG |
| cas | 321744-26-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 206.20 Pln | |
| Fluorochem | 250mg | 258.26 Pln | |
| Fluorochem | 1g | 778.91 Pln | |
| Fluorochem | 5g | 3507.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-O-tert-butyl 2-O-methyl (2R,4S)-4-hydroxypiperidine-1,2-dicarboxylate (CAS 321744-26-7) is a chemical compound with the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2R,4S)-4-hydroxypiperidine-1,2-dicarboxylate. InChIKey: RNMVWSAJMIKMDY-DTWKUNHWSA-N.
| Molecular formula | C12H21NO5 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2R,4S)-4-hydroxypiperidine-1,2-dicarboxylate |
| InChIKey | RNMVWSAJMIKMDY-DTWKUNHWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](C[C@@H]1C(=O)OC)O |
Computed by PubChem (NCBI)