CAS 187753-13-5 appears in our catalog under these names: Methyl 1-Boc-4-hydroxypiperidine-2-carboxylate, 95%, 4–Hydroxy–Piperidine–1,2–Dicarboxylic Acid 1–Tert–Butyl Ester 2–Methyl Ester, 1-tert-Butyl 2-methyl 4-hydroxypiperidine-1,2-dicarboxylate, 98%, 98%, 1-tert-Butyl 2-methyl 4-hydroxypiperidine-1,2-dicarboxylate, 96%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg, 25g.
1-O-tert-butyl 2-O-methyl 4-hydroxypiperidine-1,2-dicarboxylate (CAS 187753-13-5) is a chemical compound with the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl 4-hydroxypiperidine-1,2-dicarboxylate. InChIKey: RNMVWSAJMIKMDY-UHFFFAOYSA-N.
| Molecular formula | C12H21NO5 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl 4-hydroxypiperidine-1,2-dicarboxylate |
| InChIKey | RNMVWSAJMIKMDY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1C(=O)OC)O |
Computed by PubChem (NCBI)