CAS 321744-26-7 appears in our catalog under these names: (2R,4S)-N-Boc-4-hydroxypiperidine-2-carboxylic acid methyl ester, 95%, (2R,4S)-N-BOC-4-Hydroxypiperidine-2-carboxylic acid methyl ester, 95%, 98% ee, 1,2-Piperidinedicarboxylic acid, 4-hydroxy-, 1-(1,1-dimethylethyl) 2-methyl ester, (2R,4S)-, 97%, 97%, (2R,4S)-N-Boc-4-hydroxypiperidine-2-carboxylic acid methyl ester, 97%. Offered by: Combi-blocks, Thermo Scientific (Acros), Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g, 25g.
1-O-tert-butyl 2-O-methyl (2R,4S)-4-hydroxypiperidine-1,2-dicarboxylate (CAS 321744-26-7) is a chemical compound with the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2R,4S)-4-hydroxypiperidine-1,2-dicarboxylate. InChIKey: RNMVWSAJMIKMDY-DTWKUNHWSA-N.
| Molecular formula | C12H21NO5 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2R,4S)-4-hydroxypiperidine-1,2-dicarboxylate |
| InChIKey | RNMVWSAJMIKMDY-DTWKUNHWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](C[C@@H]1C(=O)OC)O |
Computed by PubChem (NCBI)