cas: 1639886-52-4 — see every product listed under this CAS number, including other names
(2R,5R)-2,5-Dimethylmorpholine hydrochloride 95% (CAS 1639886-52-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A452380-100mg |
| cas | 1639886-52-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 325.88 Pln | |
| Ambeed | 1g | 1060.12 Pln | |
| Ambeed | 5g | 3730.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A452380 |
(2R,5R)-2,5-dimethylmorpholine;hydrochloride (CAS 1639886-52-4) is a chemical compound with the molecular formula C6H14ClNO and a molecular weight of 151.63 g/mol. IUPAC name: (2R,5R)-2,5-dimethylmorpholine;hydrochloride. InChIKey: UIHUHFHYLUKRBX-KGZKBUQUSA-N.
| Molecular formula | C6H14ClNO |
|---|---|
| Molecular weight | 151.63 g/mol |
| IUPAC name | (2R,5R)-2,5-dimethylmorpholine;hydrochloride |
| InChIKey | UIHUHFHYLUKRBX-KGZKBUQUSA-N |
| SMILES | C[C@@H]1CN[C@@H](CO1)C.Cl |
Computed by PubChem (NCBI)