cas: 194032-41-2 — see every product listed under this CAS number, including other names
(2R,5S)-rel-tert-Butyl 2,5-dimethylpiperazine-1-carboxylate 98% (CAS 194032-41-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A442830-250mg |
| cas | 194032-41-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 353.69 Pln | |
| Ambeed | 5g | 948.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A442830 |
Tert-butyl (2R,5S)-2,5-dimethylpiperazine-1-carboxylate (CAS 194032-41-2) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl (2R,5S)-2,5-dimethylpiperazine-1-carboxylate. InChIKey: PGZCVLUQTJRRAA-DTWKUNHWSA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl (2R,5S)-2,5-dimethylpiperazine-1-carboxylate |
| InChIKey | PGZCVLUQTJRRAA-DTWKUNHWSA-N |
| SMILES | C[C@@H]1CN[C@H](CN1C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)