cas: 194032-41-2 — see every product listed under this CAS number, including other names
Trans-1-Boc-2,5-dimethylpiperazine, 97%, 97% (CAS 194032-41-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ACAF-100mg |
| cas | 194032-41-2 |
| size | 100mg |
| availability | 150g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 500mg | 165.20 Pln | |
| Chemat | 1g | 251.60 Pln | |
| Chemat | 5g | 650.00 Pln | |
| Chemat | 10g | 1168.40 Pln | |
| Chemat | 25g | 2498.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (2R,5S)-2,5-dimethylpiperazine-1-carboxylate (CAS 194032-41-2) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl (2R,5S)-2,5-dimethylpiperazine-1-carboxylate. InChIKey: PGZCVLUQTJRRAA-DTWKUNHWSA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl (2R,5S)-2,5-dimethylpiperazine-1-carboxylate |
| InChIKey | PGZCVLUQTJRRAA-DTWKUNHWSA-N |
| SMILES | C[C@@H]1CN[C@H](CN1C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)