cas: 65813-55-0 — see every product listed under this CAS number, including other names
(2RS)-2-(4-ISOBUTYRYLPHENYL)PROPANOIC ACID, 97% (CAS 65813-55-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F863714-100MG |
| cas | 65813-55-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 596.68 Pln | |
| Fluorochem | 250mg | 888.25 Pln | |
| Fluorochem | 1g | 2502.26 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-[4-(2-methylpropanoyl)phenyl]propanoic acid (CAS 65813-55-0) is a chemical compound with the molecular formula C13H16O3 and a molecular weight of 220.26 g/mol. IUPAC name: 2-[4-(2-methylpropanoyl)phenyl]propanoic acid. InChIKey: RCINGEKPKJQCMO-UHFFFAOYSA-N.
| Molecular formula | C13H16O3 |
|---|---|
| Molecular weight | 220.26 g/mol |
| IUPAC name | 2-[4-(2-methylpropanoyl)phenyl]propanoic acid |
| InChIKey | RCINGEKPKJQCMO-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)C1=CC=C(C=C1)C(C)C(=O)O |
Computed by PubChem (NCBI)