Products 43050-39-1
CAS 43050-39-1 appears in our catalog under these names: 1-(3-Methoxyphenyl)cyclopentane-1-carboxylic acid, 95%, 95%, 1–(3–Methoxyphenyl)cyclopentanecarboxylic acid, 1-(3-Methoxyphenyl)cyclopentanecarboxylic Acid, 1-(3-Methoxyphenyl)cyclopentanecarboxylic acid, 95%. Offered by: Chemat, GLPBio, Biosynth, Combi-blocks, AmBeed. Available pack sizes: 100mg, 250mg, 1g, 0,5g, 5g, 25g, 10g.
1-(3-methoxyphenyl)cyclopentane-1-carboxylic acid (CAS 43050-39-1) is a chemical compound with the molecular formula C13H16O3 and a molecular weight of 220.26 g/mol. IUPAC name: 1-(3-methoxyphenyl)cyclopentane-1-carboxylic acid. InChIKey: BDUMKMDZDPHFJH-UHFFFAOYSA-N.
| Molecular formula | C13H16O3 |
|---|---|
| Molecular weight | 220.26 g/mol |
| IUPAC name | 1-(3-methoxyphenyl)cyclopentane-1-carboxylic acid |
| InChIKey | BDUMKMDZDPHFJH-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2(CCCC2)C(=O)O |
Computed by PubChem (NCBI)