Products 30611-21-3
CAS 30611-21-3 appears in our catalog under these names: Methyl 4-pentanoylbenzoate, 95%, Methyl 4-pentanoylbenzoate, Methyl 4-pentanoylbenzoate, 98%, 4-(1-OXOPENTYL)BENZOIC ACID METHYL ESTER, 98%. Offered by: Combi-blocks, Chemat, Ambeed, BLDpharm, Fluorochem. Available pack sizes: 1g, 250mg, 50mg, 100mg.
Methyl 4-pentanoylbenzoate (CAS 30611-21-3) is a chemical compound with the molecular formula C13H16O3 and a molecular weight of 220.26 g/mol. IUPAC name: methyl 4-pentanoylbenzoate. InChIKey: LSDGSJYZSOPREL-UHFFFAOYSA-N.
| Molecular formula | C13H16O3 |
|---|---|
| Molecular weight | 220.26 g/mol |
| IUPAC name | methyl 4-pentanoylbenzoate |
| InChIKey | LSDGSJYZSOPREL-UHFFFAOYSA-N |
| SMILES | CCCCC(=O)C1=CC=C(C=C1)C(=O)OC |
Computed by PubChem (NCBI)