cas: 110529-22-1 — see every product listed under this CAS number, including other names
(2S)-1-Methyl-α,α-diphenyl-2-pyrrolidinemethanol, 97%, 97% (CAS 110529-22-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114CG8-250mg |
| cas | 110529-22-1 |
| size | 250mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 131.60 Pln | |
| Chemat | 10g | 203.60 Pln | |
| Chemat | 25g | 400.40 Pln | |
| Chemat | 100g | 1413.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
[(2S)-1-methylpyrrolidin-2-yl]-diphenylmethanol (CAS 110529-22-1) is a chemical compound with the molecular formula C18H21NO and a molecular weight of 267.4 g/mol. IUPAC name: [(2S)-1-methylpyrrolidin-2-yl]-diphenylmethanol. InChIKey: XIJAGFLYYNXCAB-KRWDZBQOSA-N.
| Molecular formula | C18H21NO |
|---|---|
| Molecular weight | 267.4 g/mol |
| IUPAC name | [(2S)-1-methylpyrrolidin-2-yl]-diphenylmethanol |
| InChIKey | XIJAGFLYYNXCAB-KRWDZBQOSA-N |
| SMILES | CN1CCC[C@H]1C(C2=CC=CC=C2)(C3=CC=CC=C3)O |
Computed by PubChem (NCBI)