cas: 110529-22-1 — see every product listed under this CAS number, including other names
(S)-(+)-2-[Hydroxy(diphenyl)methyl]-1-methylpyrrolidine, >98.0%(GC) (CAS 110529-22-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | H0768-100MG |
| cas | 110529-22-1 |
| size | 100mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 100mg | 123.26 Pln | |
| TCI | 1g | 678.91 Pln | |
| TCI | 5g | 2483.54 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
[(2S)-1-methylpyrrolidin-2-yl]-diphenylmethanol (CAS 110529-22-1) is a chemical compound with the molecular formula C18H21NO and a molecular weight of 267.4 g/mol. IUPAC name: [(2S)-1-methylpyrrolidin-2-yl]-diphenylmethanol. InChIKey: XIJAGFLYYNXCAB-KRWDZBQOSA-N.
| Molecular formula | C18H21NO |
|---|---|
| Molecular weight | 267.4 g/mol |
| IUPAC name | [(2S)-1-methylpyrrolidin-2-yl]-diphenylmethanol |
| InChIKey | XIJAGFLYYNXCAB-KRWDZBQOSA-N |
| SMILES | CN1CCC[C@H]1C(C2=CC=CC=C2)(C3=CC=CC=C3)O |
Computed by PubChem (NCBI)