(2S)-2-[4-(trifluoromethyl)phenyl]morpholine, 97%
cas: 2349772-26-3 — see every product listed under this CAS number, including other names
(2S)-2-[4-(trifluoromethyl)phenyl]morpholine, 97% (CAS 2349772-26-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch12JUEC-100mg |
| cas | 2349772-26-3 |
| size | 100mg |
| availability | 10g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 712.40 Pln | |
| Chemat | 250mg | 990.80 Pln | |
| Chemat | 500mg | 1734.80 Pln | |
| Chemat | 1g | 2848.40 Pln | |
| Chemat | 5g | 8416.40 Pln | |
| Chemat | 10g | 13989.20 Pln | |
| Fluorochem | 100mg | 1320.39 Pln | |
| Fluorochem | 250mg | 1830.62 Pln | |
| Fluorochem | 500mg | 3231.17 Pln | |
| Fluorochem | 1g | 5277.33 Pln | |
| Fluorochem | 5g | 15362.32 Pln | |
| Fluorochem | 10g | 25567.06 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-[4-(trifluoromethyl)phenyl]morpholine (CAS 2349772-26-3) is a chemical compound with the molecular formula C11H12F3NO and a molecular weight of 231.21 g/mol. IUPAC name: (2S)-2-[4-(trifluoromethyl)phenyl]morpholine. InChIKey: OMFWOWNSVWSVBC-SNVBAGLBSA-N.
| Molecular formula | C11H12F3NO |
|---|---|
| Molecular weight | 231.21 g/mol |
| IUPAC name | (2S)-2-[4-(trifluoromethyl)phenyl]morpholine |
| InChIKey | OMFWOWNSVWSVBC-SNVBAGLBSA-N |
| SMILES | C1CO[C@H](CN1)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)