cas: 2095773-02-5 — see every product listed under this CAS number, including other names
(2S)-2-AMINO-2-(4-BROMOPHENYL)ETHAN-1-OL HCL, 98% (CAS 2095773-02-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F501523-100MG |
| cas | 2095773-02-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 133.30 Pln | |
| Fluorochem | 250mg | 227.02 Pln | |
| Fluorochem | 1g | 487.35 Pln | |
| Fluorochem | 5g | 1377.66 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2S)-2-amino-2-(4-bromophenyl)ethanol;hydrochloride (CAS 2095773-02-5) is a chemical compound with the molecular formula C8H11BrClNO and a molecular weight of 252.53 g/mol. IUPAC name: (2S)-2-amino-2-(4-bromophenyl)ethanol;hydrochloride. InChIKey: PQQGURGSEYFRCS-DDWIOCJRSA-N.
| Molecular formula | C8H11BrClNO |
|---|---|
| Molecular weight | 252.53 g/mol |
| IUPAC name | (2S)-2-amino-2-(4-bromophenyl)ethanol;hydrochloride |
| InChIKey | PQQGURGSEYFRCS-DDWIOCJRSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](CO)N)Br.Cl |
Computed by PubChem (NCBI)