CAS 1916569-82-8 appears in our catalog under these names: (2R)-2-Amino-2-(4-bromophenyl)ethanol hydrochloride, 98%, (R)–2–Amino–2–(4–bromophenyl)ethanol hydrochloride, (R)-2-Amino-2-(4-Bromophenyl)Ethanol Hydrochloride, (R)-2-Amino-2-(4-bromophenyl)ethanol hydrochloride 95%, (R)-2-Amino-2-(4-bromophenyl)ethanol hydrochloride, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 10g, 100mg, 2,5g.
(2R)-2-amino-2-(4-bromophenyl)ethanol;hydrochloride (CAS 1916569-82-8) is a chemical compound with the molecular formula C8H11BrClNO and a molecular weight of 252.53 g/mol. IUPAC name: (2R)-2-amino-2-(4-bromophenyl)ethanol;hydrochloride. InChIKey: PQQGURGSEYFRCS-QRPNPIFTSA-N.
| Molecular formula | C8H11BrClNO |
|---|---|
| Molecular weight | 252.53 g/mol |
| IUPAC name | (2R)-2-amino-2-(4-bromophenyl)ethanol;hydrochloride |
| InChIKey | PQQGURGSEYFRCS-QRPNPIFTSA-N |
| SMILES | C1=CC(=CC=C1[C@H](CO)N)Br.Cl |
Computed by PubChem (NCBI)