Products 1391417-05-2
CAS 1391417-05-2 appears in our catalog under these names: (R)–2–Amino–2–(2–bromophenyl)ethanol hydrochloride, (2R)-2-Amino-2-(2-bromophenyl)ethan-1-ol hydrochloride, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
(2R)-2-amino-2-(2-bromophenyl)ethanol;hydrochloride (CAS 1391417-05-2) is a chemical compound with the molecular formula C8H11BrClNO and a molecular weight of 252.53 g/mol. IUPAC name: (2R)-2-amino-2-(2-bromophenyl)ethanol;hydrochloride. InChIKey: FHWGMOICMCKSHB-QRPNPIFTSA-N.
| Molecular formula | C8H11BrClNO |
|---|---|
| Molecular weight | 252.53 g/mol |
| IUPAC name | (2R)-2-amino-2-(2-bromophenyl)ethanol;hydrochloride |
| InChIKey | FHWGMOICMCKSHB-QRPNPIFTSA-N |
| SMILES | C1=CC=C(C(=C1)[C@H](CO)N)Br.Cl |
Computed by PubChem (NCBI)