cas: 144789-75-3 — see every product listed under this CAS number, including other names
(2S)-2-AMINO-2-[4-(TRIFLUOROMETHYL)PHENYL]ACETIC ACID, 97% (CAS 144789-75-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F514139-5G |
| cas | 144789-75-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 8880.22 Pln | |
| Fluorochem | 1g | 2720.93 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(2S)-2-amino-2-[4-(trifluoromethyl)phenyl]acetic acid (CAS 144789-75-3) is a chemical compound with the molecular formula C9H8F3NO2 and a molecular weight of 219.16 g/mol. IUPAC name: (2S)-2-amino-2-[4-(trifluoromethyl)phenyl]acetic acid. InChIKey: FANMQHUKZBBELZ-ZETCQYMHSA-N.
| Molecular formula | C9H8F3NO2 |
|---|---|
| Molecular weight | 219.16 g/mol |
| IUPAC name | (2S)-2-amino-2-[4-(trifluoromethyl)phenyl]acetic acid |
| InChIKey | FANMQHUKZBBELZ-ZETCQYMHSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](C(=O)O)N)C(F)(F)F |
Computed by PubChem (NCBI)