CAS 370-32-1 appears in our catalog under these names: 2,2,2-Trifluoroethyl phenylcarbamate, 95%, 2,2,2-Trifluoroethyl N-phenylcarbamate, 95%, 2,2,2-Trifluoroethyl N-phenylcarbamate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2,2,2-trifluoroethyl N-phenylcarbamate (CAS 370-32-1) is a chemical compound with the molecular formula C9H8F3NO2 and a molecular weight of 219.16 g/mol. IUPAC name: 2,2,2-trifluoroethyl N-phenylcarbamate. InChIKey: DWYDJEHECXADHP-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO2 |
|---|---|
| Molecular weight | 219.16 g/mol |
| IUPAC name | 2,2,2-trifluoroethyl N-phenylcarbamate |
| InChIKey | DWYDJEHECXADHP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)OCC(F)(F)F |
Computed by PubChem (NCBI)