CAS 261952-26-5 appears in our catalog under these names: 3,4,5-Trifluoro-dl-phenylalanine, 97%, 3,4,5–Trifluorophenylalanine, Phenylalanine, 3,4,5-trifluoro-, 95%, 95%, 3,4,5-Trifluoro-DL-phenylalanine. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 200mg, 100mg, 250mg.
2-amino-3-(3,4,5-trifluorophenyl)propanoic acid (CAS 261952-26-5) is a chemical compound with the molecular formula C9H8F3NO2 and a molecular weight of 219.16 g/mol. IUPAC name: 2-amino-3-(3,4,5-trifluorophenyl)propanoic acid. InChIKey: SFKCVRLOYOHGFK-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO2 |
|---|---|
| Molecular weight | 219.16 g/mol |
| IUPAC name | 2-amino-3-(3,4,5-trifluorophenyl)propanoic acid |
| InChIKey | SFKCVRLOYOHGFK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)F)CC(C(=O)O)N |
Computed by PubChem (NCBI)