cas: 757961-41-4 — see every product listed under this CAS number, including other names
(2S,3R)-Methyl 3-hydroxypyrrolidine-2-carboxylate hydrochloride, 95%, 95% (CAS 757961-41-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ICO7-100mg |
| cas | 757961-41-4 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 640.40 Pln | |
| Chemat | 250mg | 947.60 Pln | |
| Chemat | 1g | 2411.60 Pln | |
| Chemat | 5g | 10758.80 Pln | |
| Chemat | 10g | 17891.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl (2S,3R)-3-hydroxypyrrolidine-2-carboxylate;hydrochloride (CAS 757961-41-4) is a chemical compound with the molecular formula C6H12ClNO3 and a molecular weight of 181.62 g/mol. IUPAC name: methyl (2S,3R)-3-hydroxypyrrolidine-2-carboxylate;hydrochloride. InChIKey: FPZOEPPXPLBIAN-JBUOLDKXSA-N.
| Molecular formula | C6H12ClNO3 |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | methyl (2S,3R)-3-hydroxypyrrolidine-2-carboxylate;hydrochloride |
| InChIKey | FPZOEPPXPLBIAN-JBUOLDKXSA-N |
| SMILES | COC(=O)[C@@H]1[C@@H](CCN1)O.Cl |
Computed by PubChem (NCBI)