Products 841274-05-3

CAS 841274-05-3 is the registry number for 4-Methylmorpholine-2-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

4-methylmorpholine-2-carboxylic acid;hydrochloride (CAS 841274-05-3) is a chemical compound with the molecular formula C6H12ClNO3 and a molecular weight of 181.62 g/mol. IUPAC name: 4-methylmorpholine-2-carboxylic acid;hydrochloride. InChIKey: HWHCYNGGRABGQT-UHFFFAOYSA-N.

Identity
Molecular formulaC6H12ClNO3
Molecular weight181.62 g/mol
IUPAC name4-methylmorpholine-2-carboxylic acid;hydrochloride
InChIKeyHWHCYNGGRABGQT-UHFFFAOYSA-N
SMILESCN1CCOC(C1)C(=O)O.Cl

Computed by PubChem (NCBI)