Products 1255718-14-9

CAS 1255718-14-9 is the registry number for 3-(2-Isoxazolidinyl)propanoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 5g, 1g.

Structural formula: {0} (CAS {1})

3-(1,2-oxazolidin-2-yl)propanoic acid;hydrochloride (CAS 1255718-14-9) is a chemical compound with the molecular formula C6H12ClNO3 and a molecular weight of 181.62 g/mol. IUPAC name: 3-(1,2-oxazolidin-2-yl)propanoic acid;hydrochloride. InChIKey: KGEJSCNOIGFANH-UHFFFAOYSA-N.

Identity
Molecular formulaC6H12ClNO3
Molecular weight181.62 g/mol
IUPAC name3-(1,2-oxazolidin-2-yl)propanoic acid;hydrochloride
InChIKeyKGEJSCNOIGFANH-UHFFFAOYSA-N
SMILESC1CN(OC1)CCC(=O)O.Cl

Computed by PubChem (NCBI)