(2S,3R,4S,5R)-2-((S)-2-Hydroxypropyl)tetrahydro-2H-pyran-3,4,5-triol, 99%
cas: 868156-46-1 — see every product listed under this CAS number, including other names
(2S,3R,4S,5R)-2-((S)-2-Hydroxypropyl)tetrahydro-2H-pyran-3,4,5-triol, 99% (CAS 868156-46-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 1g, 5g, 10g, 15g, 50g, 75g. Offered by: BLDpharm, Chemat.
| brand | BLDpharm |
|---|---|
| catalog number | BD01106357-25g |
| cas | 868156-46-1 |
| size | 25g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| BLDpharm | 25g | 392.11 Pln | |
| BLDpharm | 100g | 864.16 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 122.00 Pln | |
| Chemat | 10g | 194.00 Pln | |
| Chemat | 15g | 251.60 Pln | |
| Chemat | 25g | 266.00 Pln | |
| Chemat | 50g | 477.20 Pln | |
| Chemat | 75g | 674.00 Pln | |
| Chemat | 100g | 827.60 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 3-4 weeks |
(2S,3R,4S,5R)-2-[(2S)-2-hydroxypropyl]oxane-3,4,5-triol (CAS 868156-46-1) is a chemical compound with the molecular formula C8H16O5 and a molecular weight of 192.21 g/mol. IUPAC name: (2S,3R,4S,5R)-2-[(2S)-2-hydroxypropyl]oxane-3,4,5-triol. InChIKey: KOGFZZYPPGQZFZ-BJNUKLAGSA-N.
| Molecular formula | C8H16O5 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | (2S,3R,4S,5R)-2-[(2S)-2-hydroxypropyl]oxane-3,4,5-triol |
| InChIKey | KOGFZZYPPGQZFZ-BJNUKLAGSA-N |
| SMILES | C[C@@H](C[C@H]1[C@@H]([C@H]([C@@H](CO1)O)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
(S)-Pro-xylane, (2S,3R,4S,5R)-2-((S)-2-Hydroxypropyl)tetrahydro-2H-pyran-3,4,5-triol, (S)-Hydroxypropyl tetrahydropyrantriol, Xylose Impurity 14, (2S,3R,4S,5R)-2-[(S)-2-Hydroxypropyl]tetrahydro-2H-pyran-3,4,5-triol, betaS2018, (2S,3R,4S,5R)-2-[(2S)-2-hydroxypropyl]oxane-3,4,5-triol, orb1690196, Hydroxypropyl tetrahydropyranetriol, (S)-Pro xylane,Hydroxypropyl tetrahydropyrantriol