CAS 107739-83-3 is the registry number for L-Noviose. Offered by: Biosynth. Available pack sizes: 1g.
(3R,4S,5R)-5-methoxy-6,6-dimethyloxane-2,3,4-triol (CAS 107739-83-3) is a chemical compound with the molecular formula C8H16O5 and a molecular weight of 192.21 g/mol. IUPAC name: (3R,4S,5R)-5-methoxy-6,6-dimethyloxane-2,3,4-triol. InChIKey: JHZJVBXDHGYVLJ-CUWOBHIPSA-N.
| Molecular formula | C8H16O5 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | (3R,4S,5R)-5-methoxy-6,6-dimethyloxane-2,3,4-triol |
| InChIKey | JHZJVBXDHGYVLJ-CUWOBHIPSA-N |
| SMILES | CC1([C@@H]([C@H]([C@H](C(O1)O)O)O)OC)C |
Computed by PubChem (NCBI)