Products 78606-80-1
CAS 78606-80-1 appears in our catalog under these names: BML–111, 5(S),6(R)-7-trihydroxymethyl Heptanoate, BML-111, BML-111 97%, Methyl (5S,6R)-5,6,7-trihydroxyheptanoate, 97%, 97%. Offered by: GLPBio, TRC, TargetMol, Ambeed, Chemat. Available pack sizes: 1mg, 25mg, 2mg, 50mg, 100mg, 10mg, 5mg, 250mg.
Methyl (5S,6R)-5,6,7-trihydroxyheptanoate (CAS 78606-80-1) is a chemical compound with the molecular formula C8H16O5 and a molecular weight of 192.21 g/mol. IUPAC name: methyl (5S,6R)-5,6,7-trihydroxyheptanoate. InChIKey: RNMFWAFZUNVQOR-NKWVEPMBSA-N.
| Molecular formula | C8H16O5 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | methyl (5S,6R)-5,6,7-trihydroxyheptanoate |
| InChIKey | RNMFWAFZUNVQOR-NKWVEPMBSA-N |
| SMILES | COC(=O)CCC[C@@H]([C@@H](CO)O)O |
Computed by PubChem (NCBI)
Synonyms:
(5S,6R)-Methyl 5,6,7-trihydroxyheptanoate, Methyl (5S,6R)-5,6,7-trihydroxyheptanoate, 5(S),6(R)-7-trihydroxymethyl Heptanoate, 5(s),6(r),7-trihydroxyheptanoic acid methyl ester, 5(S),6(R)-trihydroxy-7-heptanoic acid, methyl ester, orb1704725, 6(R)-7-trihydroxymethyl Heptanoate, 1,3-Benzodioxole-9-sulfonylchloride, Heptanoic acid, 5,6,7-trihydroxy-, methyl ester, (5S,6R)-, 5(S),6(R),7-Trihydroxyheptanoic acid methyl ester, >=98% (HPLC)