cas: 62563-15-9 — see every product listed under this CAS number, including other names
(2S,3S)-Dibutyl 2,3-dihydroxysuccinate, 95%+(GC-MS),RG, 95%+(GC-MS),RG (CAS 62563-15-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11E9QJ-5g |
| cas | 62563-15-9 |
| size | 5g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 189.20 Pln | |
| Chemat | 25g | 698.00 Pln | |
| Chemat | 100g | 2541.20 Pln |
| purity | 95%+(GC-MS),RG |
|---|---|
| delivery time | 3 weeks |
Dibutyl (2S,3S)-2,3-dihydroxybutanedioate (CAS 62563-15-9) is a chemical compound with the molecular formula C12H22O6 and a molecular weight of 262.30 g/mol. IUPAC name: dibutyl (2S,3S)-2,3-dihydroxybutanedioate. InChIKey: PCYQQSKDZQTOQG-UWVGGRQHSA-N.
| Molecular formula | C12H22O6 |
|---|---|
| Molecular weight | 262.30 g/mol |
| IUPAC name | dibutyl (2S,3S)-2,3-dihydroxybutanedioate |
| InChIKey | PCYQQSKDZQTOQG-UWVGGRQHSA-N |
| SMILES | CCCCOC(=O)[C@H]([C@@H](C(=O)OCCCC)O)O |
Computed by PubChem (NCBI)