cas: 69880-85-9 — see every product listed under this CAS number, including other names
(2S,3S,4S,5R)-3-Amino-2,4,5,6-tetrahydroxyhexanal hydrochloride, 97% (CAS 69880-85-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 100mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A922161-1g |
| cas | 69880-85-9 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 16065.07 Pln | |
| AmBeed | 250mg | 4893.91 Pln | |
| AmBeed | 100mg | 2185.75 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2S,3S,4S,5R)-3-amino-2,4,5,6-tetrahydroxyhexanal;hydrochloride (CAS 69880-85-9) is a chemical compound with the molecular formula C6H14ClNO5 and a molecular weight of 215.63 g/mol. IUPAC name: (2S,3S,4S,5R)-3-amino-2,4,5,6-tetrahydroxyhexanal;hydrochloride. InChIKey: ADFOMBKCPIMCOO-MVNLRXSJSA-N.
| Molecular formula | C6H14ClNO5 |
|---|---|
| Molecular weight | 215.63 g/mol |
| IUPAC name | (2S,3S,4S,5R)-3-amino-2,4,5,6-tetrahydroxyhexanal;hydrochloride |
| InChIKey | ADFOMBKCPIMCOO-MVNLRXSJSA-N |
| SMILES | C([C@H]([C@H]([C@@H]([C@@H](C=O)O)N)O)O)O.Cl |
Computed by PubChem (NCBI)