Products 143553-09-7
CAS 143553-09-7 appears in our catalog under these names: D-Glucosamine-1-13C hydrochloride, 95%, D-GLUCOSAMINE-1-13C HYDROCHLORIDE, &, D-Glucosamine-1-¹³C hydrochloride, Glucosamine-13C,15N (hydrochloride). Offered by: Chemat Brand, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: on request, 100MG, 1mg, 5mg.
(3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)(213C)oxane-2,4,5-triol;hydrochloride (CAS 143553-09-7) is a chemical compound with the molecular formula C6H14ClNO5 and a molecular weight of 216.62 g/mol. IUPAC name: (3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)(213C)oxane-2,4,5-triol;hydrochloride. InChIKey: QKPLRMLTKYXDST-GVSDTCGFSA-N.
| Molecular formula | C6H14ClNO5 |
|---|---|
| Molecular weight | 216.62 g/mol |
| IUPAC name | (3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)(213C)oxane-2,4,5-triol;hydrochloride |
| InChIKey | QKPLRMLTKYXDST-GVSDTCGFSA-N |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@H]([13CH](O1)O)N)O)O)O.Cl |
Computed by PubChem (NCBI)