CAS 24384-86-9 is the registry number for Kanosamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
4-amino-6-(hydroxymethyl)oxane-2,3,5-triol;hydrochloride (CAS 24384-86-9) is a chemical compound with the molecular formula C6H14ClNO5 and a molecular weight of 215.63 g/mol. IUPAC name: 4-amino-6-(hydroxymethyl)oxane-2,3,5-triol;hydrochloride. InChIKey: SSMWKOGBJREKIK-UHFFFAOYSA-N.
| Molecular formula | C6H14ClNO5 |
|---|---|
| Molecular weight | 215.63 g/mol |
| IUPAC name | 4-amino-6-(hydroxymethyl)oxane-2,3,5-triol;hydrochloride |
| InChIKey | SSMWKOGBJREKIK-UHFFFAOYSA-N |
| SMILES | C(C1C(C(C(C(O1)O)O)N)O)O.Cl |
Computed by PubChem (NCBI)